Carboxylic acid salts
![eMolecules 28643-80-3 | Nigericin sodium salt | Ambeed | MFCD30377206 | 746.955 | C40H67NaO11 | 98.000 | [Na+].CO[C@@H]1C[C@@H](C[C@H]2CC[C@H](C)[C@@H](O2)[C@@H](C)C([O-])=O)O[C@]2(O[C@@](C)(C[C@H]2C)[C@H]2CC[C@](C)(O2)[C@@H]2O[C@H](C[C@@H]2C)[C@H]2O[C@@](O)(CO)[C@H](C)C[C@@H]2C)[C@@H]1C | 250...](https://assets.fishersci.com/TFS-Assets/CCG/product-images/5000192329.jpg-250.jpg)
eMolecules 28643-80-3 | Nigericin sodium salt | Ambeed | MFCD30377206 | 746.955 | C40H67NaO11 | 98.000 | [Na+].CO[C@@H]1C[C@@H](C[C@H]2CC[C@H](C)[C@@H](O2)[C@@H](C)C([O-])=O)O[C@]2(O[C@@](C)(C[C@H]2C)[C@H]2CC[C@](C)(O2)[C@@H]2O[C@H](C[C@@H]2C)[C@H]2O[C@@](O)(CO)[C@H](C)C[C@@H]2C)[C@@H]1C | 250...
Nigericin sodium salt | Ambeed | 28643-80-3 | MFCD30377206 | 746.955 | C40H67NaO11 | 98.000 | [Na+].CO[C@@H]1C[C@@H](C[C@H]2CC[C@H](C)[C@@H](O2)[C@@H](C)C([O-])=O)O[C@]2(O[C@@](C)(C[C@H]2C)[C@H]2CC[C@](C)(O2)[C@@H]2O[C@H](C[C@@H]2C)[C@H]2O[C@@](O)(CO)[C@H](C)C[C@@H]2C)[C@@H]1C | 250mg | 865759272
eMolecules 1069-79-0 | Ambeed | (2R)-3-(((2-Aminoethoxy)(hydroxy)phosphoryl)oxy)propane-12-diyl distearate | 100mg | 592283213 | A799800 | MFCD00036777 | 748.08 | C41H82NO8P
Ambeed | 7-Nitroindoline-23-dione | 5g | 552516827 | A102459 | 112656-95-8 | MFCD02066502 | 192.130 | C8H4N2O4
If you are unable to find the chemical you are looking for, make sure you are logged into your fishersci.com account and click on the following link:
eMolecules Building Block Tool
TARGETMOL CHEMICALS INC Nigericin sodium salt, 100mg | Cas No. 28643-80-3 | Purity: 99.52%
Nigericin sodium salt is an antibiotic, an NLRP3 activator, and a cationic ion carrier. Nigericin sodium triggers the activation of the NALP3 inflammasome, which inhibits Golgi function and suppresses the growth of Gram-positive bacteria.
Sigma Aldrich Fine Chemicals Biosciences Sodium formate BioUltra, >=99.0% (NT) | 141-53-7 | MFCD00013101 | 1KG
Sodium formate BioUltra, >=99.0% (NT) | Purity: >=99.0% (NT) | Mol Wt: 68.01 | 141-53-7 | MFCD00013101 | 1KG
Selleck Chemical LLC Taurocholic acid sodium salt
Taurocholic acid sodium salt (Sodium Taurocholate TANa) is a sodium salt of taurocholic acid and occurs in the bile of mammals Taurocholic acid is used as a cholagogue and choleretic
Supply Solutions Sigma Aldrich Inc.-Sodium Succinate Dibasic Hexa
Sigma Aldrich Inc.-Sodium Succinate Dibasic Hexa
Chem-Impex International, Inc. Ammonium citrate dibasic | MFCD00013068 | 1KG
Ammonium citrate dibasic, MFCD00013068, 1KG
eMolecules 16980-89-5 | N-6,O-2'-Dibutyryladenosine cyclic 3',5'-monophosphate sodium salt | AA Blocks LLC | MFCD00005843 | 491.373 | C18H23N5NaO8P | 0.000 | [Na+].CCCC(=O)Nc1ncnc2n(cnc12)[C@@H]1O[C@@H]2COP([O-])(=O)O[C@H]2[C@H]1OC(=O)CCC | 1mg | 761900999
N-6,O-2'-Dibutyryladenosine cyclic 3',5'-monophosphate sodium salt | AA Blocks LLC | 16980-89-5 | MFCD00005843 | 491.373 | C18H23N5NaO8P | 0.000 | [Na+].CCCC(=O)Nc1ncnc2n(cnc12)[C@@H]1O[C@@H]2COP([O-])(=O)O[C@H]2[C@H]1OC(=O)CCC | 1mg | 761900999
Sigma Aldrich Fine Chemicals Biosciences Anisyl formate | 122-91-8 | MFCD00021045 |
Anisyl formate | Purity: 90% | MW: 166.17 | 122-91-8 | MFCD00021045 | 0
Sigma Aldrich Fine Chemicals Biosciences Sodium formate | 141-53-7 | MFCD00013101 | 100 g
Sodium formate | Purity: ≥99% | Mol Wt: 68.01 | 141-53-7 | MFCD00013101 | 100 g
Sigma Aldrich Fine Chemicals Biosciences Sodium formate anhydrous, free-flowing, Redi-Dri(TM), ACS reagent, >=99% | 141-53-7 | MFCD00013101 | 500G
Sodium formate anhydrous, free-flowing, Redi-Dri(TM), ACS reagent, >=99% | Purity: >=99% | Mol Wt: 68.01 | 141-53-7 | MFCD00013101 | 500G